ethyl 2-(benzenecarbonothioylsulfanyl)propanoate structure
|
Common Name | ethyl 2-(benzenecarbonothioylsulfanyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 412015-83-9 | Molecular Weight | 254.36800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O2S2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | >230 °F | |
| Name | ethyl 2-(benzenecarbonothioylsulfanyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O2S2 |
|---|---|
| Molecular Weight | 254.36800 |
| Exact Mass | 254.04400 |
| PSA | 83.69000 |
| LogP | 3.04690 |
| InChIKey | NXWVPIWRMPQYEX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)SC(=S)c1ccccc1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| Flash Point(F) | >230 °F |
| Flash Point(C) | >110 °C |
|
~%
ethyl 2-(benzen... CAS#:412015-83-9 |
| Literature: Meiser, Wibke; Barth, Johannes; Buback, Michael; Kattner, Hendrik; Vana, Philipp Macromolecules, 2011 , vol. 44, # 8 p. 2474 - 2480 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Universal (switchable) RAFT agents.
Material Matters 5 , 2, (2010) The polymerization of most monomers that are polymerizable by radical polymerization can be controlled by the reversible addition-fragmentation chain transfer (RAFT) process. However, it is usually re... |
|
|
RAFT Agent Design and Synthesis Keddie, D. J.; et al.
Macromolecules 45 , 5321-5342, (2012)
|
| ethyl S-thiobenzoyl-2-thiopropionate |
| Propanoic acid,2-[(phenylthioxomethyl)thi]-,ethyl ester |
| Propanoic acid,2-[(phenylthioxomethyl)thio]-,ethyl ester |
| Ethyl 2-(phenylcarbonothioylthio)propionate |