methyl 2-[[2-(naphthalen-2-ylsulfonylamino)acetyl]amino]acetate
Modify Date: 2025-09-16 08:49:19
![methyl 2-[[2-(naphthalen-2-ylsulfonylamino)acetyl]amino]acetate Structure](https://image.chemsrc.com/caspic/367/4073-03-4.png)
methyl 2-[[2-(naphthalen-2-ylsulfonylamino)acetyl]amino]acetate structure
|
Common Name | methyl 2-[[2-(naphthalen-2-ylsulfonylamino)acetyl]amino]acetate | ||
|---|---|---|---|---|
| CAS Number | 4073-03-4 | Molecular Weight | 336.36300 | |
| Density | 1.347g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[[2-(naphthalen-2-ylsulfonylamino)acetyl]amino]acetate |
|---|
| Density | 1.347g/cm3 |
|---|---|
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.36300 |
| Exact Mass | 336.07800 |
| PSA | 113.44000 |
| LogP | 2.71930 |
| Index of Refraction | 1.601 |
| InChIKey | FZUXCGIARMPEGV-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)CNS(=O)(=O)c1ccc2ccccc2c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |