N-(2-ethoxyethyl)-2-nitrobenzenesulfonamide structure
|
Common Name | N-(2-ethoxyethyl)-2-nitrobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 4066-18-6 | Molecular Weight | 274.29400 | |
| Density | 1.32g/cm3 | Boiling Point | 428.6ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | N-(2-ethoxyethyl)-2-nitrobenzenesulfonamide |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 428.6ºC at 760 mmHg |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.29400 |
| Flash Point | 213ºC |
| Exact Mass | 274.06200 |
| PSA | 109.60000 |
| LogP | 2.90450 |
| Vapour Pressure | 1.5E-07mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | VYJAZZQMPZXLRI-UHFFFAOYSA-N |
| SMILES | CCOCCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |