3-hydroperoxy-3-methyl-2-phenylindole
Modify Date: 2025-11-24 22:21:49
3-hydroperoxy-3-methyl-2-phenylindole structure
|
Common Name | 3-hydroperoxy-3-methyl-2-phenylindole | ||
|---|---|---|---|---|
| CAS Number | 39608-24-7 | Molecular Weight | 239.26900 | |
| Density | 1.18g/cm3 | Boiling Point | 399ºC at 760 mmHg | |
| Molecular Formula | C15H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.1ºC | |
| Name | 3-hydroperoxy-3-methyl-2-phenylindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 399ºC at 760 mmHg |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.26900 |
| Flash Point | 195.1ºC |
| Exact Mass | 239.09500 |
| PSA | 41.82000 |
| LogP | 2.96140 |
| Index of Refraction | 1.607 |
| InChIKey | JIDQYPYCJTXPKO-UHFFFAOYSA-N |
| SMILES | CC1(OO)C(c2ccccc2)=Nc2ccccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Phenyl-3-methyl-3-hydroperoxyindolenin |
| 3-Hydroperoxy-3-methyl-2-phenylindolenine |
| 3-hydroperoxy-3-methyl-2-phenyl-3H-indole |
| 2-Phenyl-3-methyl-indolenyl-3-hydroperoxid |
| 3-Hydroperoxy-3-methyl-2-phenyl-indolenin |
| 3-Methyl-2-phenyl-3H-indol-3-ylhydroperoxid |
| 3-Methyl-2-phenyl-3H-indol-3-yl hydroperoxide |