3-(4-chlorophenyl)-2-cyanoprop-2-enethioamide
Modify Date: 2025-08-25 10:51:16
3-(4-chlorophenyl)-2-cyanoprop-2-enethioamide structure
|
Common Name | 3-(4-chlorophenyl)-2-cyanoprop-2-enethioamide | ||
|---|---|---|---|---|
| CAS Number | 39145-33-0 | Molecular Weight | 222.69400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-chlorophenyl)-2-cyanoprop-2-enethioamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7ClN2S |
|---|---|
| Molecular Weight | 222.69400 |
| Exact Mass | 222.00200 |
| PSA | 86.44000 |
| LogP | 3.25378 |
| InChIKey | RZHHDALLVIGWBS-UHFFFAOYSA-N |
| SMILES | N#CC(=Cc1ccc(Cl)cc1)C(N)=S |
|
~97%
3-(4-chlorophen... CAS#:39145-33-0 |
| Literature: Bandgar; Zirange; Wadgaonkar Synthetic Communications, 1997 , vol. 27, # 7 p. 1153 - 1156 |
|
~%
3-(4-chlorophen... CAS#:39145-33-0 |
| Literature: Brunskill, John S. A.; De, Asish; Ewing, David F. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 4 - 7 |
CAS#:6265-91-4
CAS#:102423-75-6![Propanedinitrile,2-[(4-chlorophenyl)methylene]- structure](https://image.chemsrc.com/caspic/058/1867-38-5.png)
CAS#:1867-38-5
CAS#:13437-75-7| 2-Propenethioamide,3-(4-chlorophenyl)-2-cyano |
| 2-(aminothioxomethyl)-3-(4-chlorophenyl)-prop-2-ennitrile |
| p-Chlorobenzylidenecyanothioacetamide |
| p-Chlorophenylmethylenecyanothioacetamide |
| 4-chlorobenzylidenecyanothioacetamide |