2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate
Modify Date: 2026-06-29 18:11:13
2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate structure
|
Common Name | 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 381229-84-1 | Molecular Weight | 323.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3Cl2F3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H3Cl2F3O4S |
|---|---|
| Molecular Weight | 323.07 |
| InChIKey | NOZJBKPQUGRKNT-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(Cl)c(OS(=O)(=O)C(F)(F)F)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate? |
| A: Molecular weight of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate is 323.07. |
| Q: What is the SMILES notation of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate? |
| A: SMILES notation of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate is O=Cc1cc(Cl)c(OS(=O)(=O)C(F)(F)F)cc1Cl. |
| Q: What is the Chinese name of 381229-84-1? |
| A: Chinese name of 381229-84-1 is 381229-84-1. |
| Q: What is the English name of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate? |
| A: The English name of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate is 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate. |
| Q: What is the CAS number of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate? |
| A: CAS number of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate is 381229-84-1. |
| Q: What is the molecular formula of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate? |
| A: Molecular formula of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate is C8H3Cl2F3O4S. |
| Q: What is the InChIKey of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate? |
| A: InChIKey of 2,5-Dichloro-4-formylphenyl trifluoromethanesulfonate is NOZJBKPQUGRKNT-UHFFFAOYSA-N. |