2,3-dichloro-2,3-difluorobutanedioic acid structure
|
Common Name | 2,3-dichloro-2,3-difluorobutanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 377-34-4 | Molecular Weight | 222.95900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H2Cl2F2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-dichloro-2,3-difluorobutanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H2Cl2F2O4 |
|---|---|
| Molecular Weight | 222.95900 |
| Exact Mass | 221.93000 |
| PSA | 74.60000 |
| LogP | 0.96480 |
| InChIKey | DNNMVKPGIKEQGO-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(Cl)C(F)(Cl)C(=O)O |
|
~%
2,3-dichloro-2,... CAS#:377-34-4 |
| Literature: Haszeldine; Osborne Journal of the Chemical Society, 1955 , p. 3880,3887 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Butanedioic acid,2,3-dichloro-2,3-difluoro |
| 2.3-Dichlor-2.3-difluor-bernsteinsaeure |
| 2,3-dichloro-2,3-difluoro-succinic acid |