N-[4-(4-Bromophenoxy)phenyl]-2-chloroacetamide
Modify Date: 2025-09-26 17:03:12
![N-[4-(4-Bromophenoxy)phenyl]-2-chloroacetamide Structure](https://image.chemsrc.com/caspic/273/36160-96-0.png)
N-[4-(4-Bromophenoxy)phenyl]-2-chloroacetamide structure
|
Common Name | N-[4-(4-Bromophenoxy)phenyl]-2-chloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 36160-96-0 | Molecular Weight | 340.60000 | |
| Density | 1.543g/cm3 | Boiling Point | 478.561ºC at 760 mmHg | |
| Molecular Formula | C14H11BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.225ºC | |
| Name | N-[4-(4-Bromophenoxy)phenyl]-2-chloroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.543g/cm3 |
|---|---|
| Boiling Point | 478.561ºC at 760 mmHg |
| Molecular Formula | C14H11BrClNO2 |
| Molecular Weight | 340.60000 |
| Flash Point | 243.225ºC |
| Exact Mass | 338.96600 |
| PSA | 38.33000 |
| LogP | 4.49170 |
| Index of Refraction | 1.64 |
| InChIKey | MPWWBEFBRKTSIC-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccc(Oc2ccc(Br)cc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-[4-(4-Bromoph... CAS#:36160-96-0 |
| Literature: Kurihara; Ro J.Tohoku Coll.Pharm.Chem.Abstr., 1956 , # 3 p. 63,67 J.Tohoku Coll.Pharm.Chem.Abstr., 1957 , p. 5718 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Chlor-essigsaeure-[4-(4-brom-phenoxy)-anilid] |
| chloro-acetic acid-[4-(4-bromo-phenoxy)-anilide] |