2-pyridin-4-yl-4,6-bis(trichloromethyl)-1,3,5-triazine structure
|
Common Name | 2-pyridin-4-yl-4,6-bis(trichloromethyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 3599-73-3 | Molecular Weight | 392.88400 | |
| Density | 1.706g/cm3 | Boiling Point | 457.4ºC at 760 mmHg | |
| Molecular Formula | C10H4Cl6N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.9ºC | |
| Name | 2-pyridin-4-yl-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|
| Density | 1.706g/cm3 |
|---|---|
| Boiling Point | 457.4ºC at 760 mmHg |
| Molecular Formula | C10H4Cl6N4 |
| Molecular Weight | 392.88400 |
| Flash Point | 262.9ºC |
| Exact Mass | 389.85700 |
| PSA | 51.56000 |
| LogP | 4.58700 |
| Index of Refraction | 1.623 |
| InChIKey | XBEUJFDLKDNYAU-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)c1nc(-c2ccncc2)nc(C(Cl)(Cl)Cl)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |