N-[1-[3-(1H-indol-3-yl)-3-oxopropyl]piperidin-4-yl]benzamide
Modify Date: 2025-11-26 17:47:06
![N-[1-[3-(1H-indol-3-yl)-3-oxopropyl]piperidin-4-yl]benzamide Structure](https://image.chemsrc.com/caspic/489/35631-19-7.png)
N-[1-[3-(1H-indol-3-yl)-3-oxopropyl]piperidin-4-yl]benzamide structure
|
Common Name | N-[1-[3-(1H-indol-3-yl)-3-oxopropyl]piperidin-4-yl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 35631-19-7 | Molecular Weight | 375.46400 | |
| Density | 1.25g/cm3 | Boiling Point | 661.8ºC at 760 mmHg | |
| Molecular Formula | C23H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354ºC | |
| Name | N-[1-[3-(1H-indol-3-yl)-3-oxopropyl]piperidin-4-yl]benzamide |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 661.8ºC at 760 mmHg |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.46400 |
| Flash Point | 354ºC |
| Exact Mass | 375.19500 |
| PSA | 68.69000 |
| LogP | 4.14780 |
| Index of Refraction | 1.657 |
| InChIKey | LINUMTAMFLKELL-UHFFFAOYSA-N |
| SMILES | O=C(NC1CCN(CCC(=O)c2c[nH]c3ccccc23)CC1)c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |