1-[2,2-dichloro-1-(4-nitrophenyl)ethyl]-4-nitrobenzene structure
|
Common Name | 1-[2,2-dichloro-1-(4-nitrophenyl)ethyl]-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 35509-87-6 | Molecular Weight | 341.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2,2-dichloro-1-(4-nitrophenyl)ethyl]-4-nitrobenzene |
|---|
| Molecular Formula | C14H10Cl2N2O4 |
|---|---|
| Molecular Weight | 341.14600 |
| Exact Mass | 340.00200 |
| PSA | 91.64000 |
| LogP | 5.48500 |
| InChIKey | UYPZQFROUBZKJG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(c2ccc([N+](=O)[O-])cc2)C(Cl)Cl)cc1 |
|
~%
1-[2,2-dichloro... CAS#:35509-87-6 |
| Literature: McLennan,D.J.; Wong,R.J. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1972 , p. 279 - 286 |