5-tert-butyl-1,3-bis(chloromethyl)-2-methylbenzene structure
|
Common Name | 5-tert-butyl-1,3-bis(chloromethyl)-2-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 35322-87-3 | Molecular Weight | 245.18800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-tert-butyl-1,3-bis(chloromethyl)-2-methylbenzene |
|---|
| Molecular Formula | C13H18Cl2 |
|---|---|
| Molecular Weight | 245.18800 |
| Exact Mass | 244.07900 |
| LogP | 4.77010 |
| InChIKey | GLSKBMMFIQKAQX-UHFFFAOYSA-N |
| SMILES | Cc1c(CCl)cc(C(C)(C)C)cc1CCl |
|
~%
5-tert-butyl-1,... CAS#:35322-87-3 |
| Literature: Kemp,W.; Spanswick,J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 151 - 155 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |