[2-[[4-(dimethylamino)phenyl]diazenyl]phenyl]methanol structure
|
Common Name | [2-[[4-(dimethylamino)phenyl]diazenyl]phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 35282-68-9 | Molecular Weight | 255.31500 | |
| Density | 1.09g/cm3 | Boiling Point | 444.7ºC at 760 mmHg | |
| Molecular Formula | C15H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.7ºC | |
| Name | [2-[[4-(dimethylamino)phenyl]diazenyl]phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 444.7ºC at 760 mmHg |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.31500 |
| Flash Point | 222.7ºC |
| Exact Mass | 255.13700 |
| PSA | 48.19000 |
| LogP | 3.66030 |
| Index of Refraction | 1.576 |
| InChIKey | IMAVJBXAMPPGAO-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Nc2ccccc2CO)cc1 |
|
~%
[2-[[4-(dimethy... CAS#:35282-68-9 |
| Literature: Mori; Niwa; Toyoshi Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 5 p. 1439 - 1442 |
| BENZYL ALCOHOL,o-((p-DIMETHYLAMINOPHENYL)AZO) |
| Benzenemethanol,2-((4-(dimethylamino)phenyl)azo) |
| o-((p-Dimethylaminophenyl)azo)benzyl alcohol |
| 2-((4-(Dimethylamino)phenyl)azo)benzenemethanol |
| 2'-Hydroxymethyl-N,N-dimethyl-4-aminoazobenzene |
| [2-[(4-dimethylaminophenyl)diazenyl]phenyl]methanol |