1,2,3,4-tetrachloro-5,8-dihydroxyanthracene-9,10-dione structure
|
Common Name | 1,2,3,4-tetrachloro-5,8-dihydroxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 34234-10-1 | Molecular Weight | 377.99100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H4Cl4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,4-tetrachloro-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H4Cl4O4 |
|---|---|
| Molecular Weight | 377.99100 |
| Exact Mass | 375.88600 |
| PSA | 74.60000 |
| LogP | 4.48680 |
| InChIKey | WABFZNNQLRGYNF-UHFFFAOYSA-N |
| SMILES | O=C1c2c(O)ccc(O)c2C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c21 |
|
~90%
1,2,3,4-tetrach... CAS#:34234-10-1 |
| Literature: Ming, Lee Tang; Joon, Hak Oh; Reichardt, Anna Devi; Bao, Zhenan Journal of the American Chemical Society, 2009 , vol. 131, p. 3733 - 3740 |
|
~%
1,2,3,4-tetrach... CAS#:34234-10-1 |
| Literature: Hoevermann Chemische Berichte, 1914 , vol. 47, p. 1212 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,2,3,4-tetrachloro-5,8-dihydroxy-anthraquinone |
| 1,2,3,4-Tetrachlor-5,8-dihydroxy-anthrachinon |
| 9,10-Anthracenedione,1,2,3,4-tetrachloro-5,8-dihydroxy |
| 1,2,3,4-tetrachloro-5,8-dihydroxy-9,10-anthracenedione |