methyl 2-[2-(decanoylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoate
Modify Date: 2025-08-25 17:42:19
![methyl 2-[2-(decanoylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoate Structure](https://image.chemsrc.com/caspic/241/31944-64-6.png)
methyl 2-[2-(decanoylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoate structure
|
Common Name | methyl 2-[2-(decanoylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 31944-64-6 | Molecular Weight | 394.50800 | |
| Density | 1.103g/cm3 | Boiling Point | 672.8ºC at 760mmHg | |
| Molecular Formula | C20H34N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.7ºC | |
| Name | methyl 2-[2-(decanoylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoate |
|---|
| Density | 1.103g/cm3 |
|---|---|
| Boiling Point | 672.8ºC at 760mmHg |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.50800 |
| Flash Point | 360.7ºC |
| Exact Mass | 394.25800 |
| PSA | 120.16000 |
| LogP | 3.93600 |
| Index of Refraction | 1.509 |
| InChIKey | MJMCWQGJZURFBP-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)NC(C)C(=O)NC(Cc1cnc[nH]1)C(=O)OC |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |