5-amino-N-cyclopropyl-2-prop-2-ynoxybenzamide
Modify Date: 2025-11-25 20:41:39
5-amino-N-cyclopropyl-2-prop-2-ynoxybenzamide structure
|
Common Name | 5-amino-N-cyclopropyl-2-prop-2-ynoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 30533-79-0 | Molecular Weight | 230.26200 | |
| Density | 1.24g/cm3 | Boiling Point | 432.4ºC at 760mmHg | |
| Molecular Formula | C13H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.3ºC | |
| Name | 5-amino-N-cyclopropyl-2-prop-2-ynoxybenzamide |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 432.4ºC at 760mmHg |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.26200 |
| Flash Point | 215.3ºC |
| Exact Mass | 230.10600 |
| PSA | 67.84000 |
| LogP | 2.32900 |
| Index of Refraction | 1.605 |
| InChIKey | RBHMPGGPZUKPLD-UHFFFAOYSA-N |
| SMILES | C#CCOc1ccc(N)cc1C(=O)NC1CC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |