2-(2,5-dichloro-4-methoxyphenoxy)acetic acid structure
|
Common Name | 2-(2,5-dichloro-4-methoxyphenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 30364-07-9 | Molecular Weight | 251.06300 | |
| Density | 1.455g/cm3 | Boiling Point | 385.2ºC at 760mmHg | |
| Molecular Formula | C9H8Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.7ºC | |
| Name | 2-(2,5-dichloro-4-methoxyphenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 385.2ºC at 760mmHg |
| Molecular Formula | C9H8Cl2O4 |
| Molecular Weight | 251.06300 |
| Flash Point | 186.7ºC |
| Exact Mass | 249.98000 |
| PSA | 55.76000 |
| LogP | 2.46540 |
| Index of Refraction | 1.557 |
| InChIKey | GZMRIBIYYBDLSZ-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)c(OCC(=O)O)cc1Cl |
|
~%
2-(2,5-dichloro... CAS#:30364-07-9 |
| Literature: Faulkner,J.K.; Woodcock,D. Journal of the Chemical Society, 1965 , p. 1187 - 1191 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,5-Dichloro-4-methoxyphenoxyacetic acid |