(2,4-dimethoxyphenyl)-phenyldiazene structure
|
Common Name | (2,4-dimethoxyphenyl)-phenyldiazene | ||
|---|---|---|---|---|
| CAS Number | 29418-46-0 | Molecular Weight | 242.27300 | |
| Density | 1.09g/cm3 | Boiling Point | 394.3ºC at 760mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.5ºC | |
| Name | (2,4-dimethoxyphenyl)-phenyldiazene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 394.3ºC at 760mmHg |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27300 |
| Flash Point | 155.5ºC |
| Exact Mass | 242.10600 |
| PSA | 43.18000 |
| LogP | 4.11920 |
| Vapour Pressure | 4.56E-06mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | ILPDRVDQZSFGNG-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=Nc2ccccc2)c(OC)c1 |
|
~%
(2,4-dimethoxyp... CAS#:29418-46-0 |
| Literature: Woroshzow; Gor'kow Zhurnal Obshchei Khimii, 1932 , vol. 2, p. 421,429 Chem.Abstr., 1033 968 |
|
~%
(2,4-dimethoxyp... CAS#:29418-46-0 |
| Literature: Cook; Jones Journal of the Chemical Society, 1939 , p. 1309,1313 |
(2,4-dimethoxyp... CAS#:29418-46-0 ~%
(2,4-dimethoxyp... CAS#:29418-46-0 |
| Literature: Cook; Jones Journal of the Chemical Society, 1939 , p. 1309,1313 |
| 2,4-DIMETHOXYAZOBENZENE |
| 2.4-Dimethoxy-trans-azobenzol |