N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)phenyl]benzamide structure
|
Common Name | N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)phenyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 29368-93-2 | Molecular Weight | 341.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)phenyl]benzamide |
|---|
| Molecular Formula | C21H15N3O2 |
|---|---|
| Molecular Weight | 341.36300 |
| Exact Mass | 341.11600 |
| PSA | 71.51000 |
| LogP | 5.03990 |
| InChIKey | FMYTWBYUSUNPKZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1-c1noc(-c2ccccc2)n1)c1ccccc1 |
|
~84%
N-[2-(5-phenyl-... CAS#:29368-93-2 |
| Literature: Korbonits, Dezsoe; Kolonits, Pal Acta Chimica Hungarica, 1990 , vol. 127, # 6 p. 795 - 802 |
|
~%
N-[2-(5-phenyl-... CAS#:29368-93-2 |
| Literature: Korbonits, Dezsoe; Kanzel-Szvoboda, Ida; Horvath, Karoly Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , p. 759 - 766 |
|
~%
N-[2-(5-phenyl-... CAS#:29368-93-2 |
| Literature: Korbonits, Dezsoe; Kanzel-Szvoboda, Ida; Horvath, Karoly Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , p. 759 - 766 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |