N,N-bis(2,2-dinitropropyl)nitramide structure
|
Common Name | N,N-bis(2,2-dinitropropyl)nitramide | ||
|---|---|---|---|---|
| CAS Number | 28464-24-6 | Molecular Weight | 326.17800 | |
| Density | 1.64g/cm3 | Boiling Point | 530.3ºC at 760 mmHg | |
| Molecular Formula | C6H10N6O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.5ºC | |
| Name | N,N-bis(2,2-dinitropropyl)nitramide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 530.3ºC at 760 mmHg |
| Molecular Formula | C6H10N6O10 |
| Molecular Weight | 326.17800 |
| Flash Point | 274.5ºC |
| Exact Mass | 326.04600 |
| PSA | 232.34000 |
| LogP | 1.63530 |
| Vapour Pressure | 2.49E-11mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | UGOPZXCLZKDIKQ-UHFFFAOYSA-N |
| SMILES | CC(CN(CC(C)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
|
~%
N,N-bis(2,2-din... CAS#:28464-24-6 |
| Literature: Ungnade,H.E.; Kissinger,L.W. Journal of Organic Chemistry, 1965 , vol. 30, p. 354 - 359 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Bis-(2,2-dinitropropyl)nitro-amin |
| Bis-(2,2-dinitro-propyl)-nitramin |
| Bis-(2,2-dinitropropyl)-N-nitroamin |
| bis(2,2-dinitropropyl)-nitramine |
| N-(2,2-dinitropropyl)-N,2,2-trinitropropan-1-amine |
| N-Nitrobis(2,2-dinitropropyl)amine |