methyl 7-methoxy-2-oxo-4,5-dihydro-3H-cyclopenta[a]naphthalene-3a-carboxylate structure
|
Common Name | methyl 7-methoxy-2-oxo-4,5-dihydro-3H-cyclopenta[a]naphthalene-3a-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 27752-29-0 | Molecular Weight | 272.29600 | |
| Density | 1.26g/cm3 | Boiling Point | 421ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.5ºC | |
| Name | methyl 7-methoxy-2-oxo-4,5-dihydro-3H-cyclopenta[a]naphthalene-3a-carboxylate |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 421ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 187.5ºC |
| Exact Mass | 272.10500 |
| PSA | 52.60000 |
| LogP | 2.15700 |
| Vapour Pressure | 2.68E-07mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | VMPSZQWRHSUGEL-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCc3cc(OC)ccc3C1=CC(=O)C2 |
|
~%
methyl 7-methox... CAS#:27752-29-0 |
| Literature: Juday; Bukwa; Kaiser; Webb Journal of medicinal chemistry, 1970 , vol. 13, # 2 p. 314 - 317 |
|
~%
methyl 7-methox... CAS#:27752-29-0 |
| Literature: Juday; Bukwa; Kaiser; Webb Journal of medicinal chemistry, 1970 , vol. 13, # 2 p. 314 - 317 |
|
~%
methyl 7-methox... CAS#:27752-29-0 |
| Literature: Juday; Bukwa; Kaiser; Webb Journal of medicinal chemistry, 1970 , vol. 13, # 2 p. 314 - 317 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |