but-3-enoic acid,butyl prop-2-enoate,chloroethene structure
|
Common Name | but-3-enoic acid,butyl prop-2-enoate,chloroethene | ||
|---|---|---|---|---|
| CAS Number | 26590-01-2 | Molecular Weight | 276.75600 | |
| Density | N/A | Boiling Point | 145.9ºC at 760mmHg | |
| Molecular Formula | C13H21ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 39.4ºC | |
| Name | but-3-enoic acid,butyl prop-2-enoate,chloroethene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 145.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H21ClO4 |
| Molecular Weight | 276.75600 |
| Flash Point | 39.4ºC |
| Exact Mass | 276.11300 |
| PSA | 63.60000 |
| LogP | 3.53150 |
| Vapour Pressure | 4.75mmHg at 25°C |
| InChIKey | CPLNIOPRXXUJHT-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCCC.C=CCC(=O)O.C=CCl |
| 2-Propenoic acid,butyl ester,polymer with chloroethene and ethenyl acetate |
| Vinyl acetate,butyl acrylate,vinyl chloride polymer |