9-chloro-10-hydroxyoctadecanoic acid structure
|
Common Name | 9-chloro-10-hydroxyoctadecanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2632-61-3 | Molecular Weight | 334.92200 | |
| Density | 1.015g/cm3 | Boiling Point | 461.7ºC at 760mmHg | |
| Molecular Formula | C18H35ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233ºC | |
| Name | 9-chloro-10-hydroxyoctadecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.015g/cm3 |
|---|---|
| Boiling Point | 461.7ºC at 760mmHg |
| Molecular Formula | C18H35ClO3 |
| Molecular Weight | 334.92200 |
| Flash Point | 233ºC |
| Exact Mass | 334.22700 |
| PSA | 57.53000 |
| LogP | 5.52060 |
| Vapour Pressure | 1.82E-10mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | OBJQYZRZIIFTBJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(O)C(Cl)CCCCCCCC(=O)O |
|
~%
9-chloro-10-hyd... CAS#:2632-61-3 |
| Literature: Kuranova,I.L.; Balykina,L.V. Journal of Organic Chemistry USSR (English Translation), 1975 , vol. 11, p. 716 - 721 Zhurnal Organicheskoi Khimii, 1975 , vol. 11, p. 720 - 726 |
|
~%
9-chloro-10-hyd... CAS#:2632-61-3 |
| Literature: Atherton; Hilditch Journal of the Chemical Society, 1943 , p. 207 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9-Chlor-10-hydroxy-octadecansaeure |
| erythro-9-Chlor-10-hydroxyoctadecansaeure |
| erytho-9-Chlor-10-hydroxy-stearinsaeure |
| erytho-9-Chlor-10-hydroxy-octadecansaeure |
| Octadecanoic acid,9-chloro-10-hydroxy |
| 9-chloro-10-hydroxy-octadecanoic acid |
| 18:0(9Cl,10OH) |
| (+-)-erythro-9-chloro-10-hydroxy-octadecanoic acid |