rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate
Modify Date: 2026-08-27 18:58:42
![rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate Structure](https://www.chemsrc.com/extcaspic/322/2580098-44-6.png)
rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate structure
|
Common Name | rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2580098-44-6 | Molecular Weight | 212.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H12N4O3 |
|---|---|
| Molecular Weight | 212.21 |
| InChIKey | MMGUHIKUWWPKJQ-CAHLUQPWSA-N |
| SMILES | COC(=O)c1cn(C2COCC2N)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2580098-44-6? |
| A: Chinese name of 2580098-44-6 is 2580098-44-6. |
| Q: What is the SMILES notation of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate? |
| A: SMILES notation of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate is COC(=O)c1cn(C2COCC2N)nn1. |
| Q: What is the molecular formula of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular formula of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate is C8H12N4O3. |
| Q: What is the CAS number of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate? |
| A: CAS number of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate is 2580098-44-6. |
| Q: What is the English name of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate? |
| A: The English name of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate is rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate. |
| Q: What is the InChIKey of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate? |
| A: InChIKey of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate is MMGUHIKUWWPKJQ-CAHLUQPWSA-N. |
| Q: What is the molecular weight of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular weight of rac-methyl 1-[(3R,4S)-4-aminooxolan-3-yl]-1H-1,2,3-triazole-4-carboxylate is 212.21. |