ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate
Modify Date: 2026-09-22 10:38:40
![ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate Structure](https://www.chemsrc.com/extcaspic/236/2580098-02-6.png)
ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate structure
|
Common Name | ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2580098-02-6 | Molecular Weight | 209.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NO2 |
|---|---|
| Molecular Weight | 209.28 |
| InChIKey | OSURAGVIEJWRMU-DPONANGWSA-N |
| SMILES | CCOC(=O)C1CC2C3CNCC3C2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate? |
| A: InChIKey of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate is OSURAGVIEJWRMU-DPONANGWSA-N. |
| Q: What is the English name of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate? |
| A: The English name of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate is ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate. |
| Q: What is the SMILES notation of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate? |
| A: SMILES notation of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate is CCOC(=O)C1CC2C3CNCC3C2C1. |
| Q: What is the molecular formula of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate? |
| A: Molecular formula of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate is C12H19NO2. |
| Q: What is the Chinese name of 2580098-02-6? |
| A: Chinese name of 2580098-02-6 is 2580098-02-6. |
| Q: What is the molecular weight of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate? |
| A: Molecular weight of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate is 209.28. |
| Q: What is the CAS number of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate? |
| A: CAS number of ethyl (1R,2S,6R,7S)-4-azatricyclo[5.3.0.0,2,6]decane-9-carboxylate is 2580098-02-6. |