ethyl (3R)-3-amino-2,2,4-trimethylpentanoate
Modify Date: 2025-11-04 17:59:11
ethyl (3R)-3-amino-2,2,4-trimethylpentanoate structure
|
Common Name | ethyl (3R)-3-amino-2,2,4-trimethylpentanoate | ||
|---|---|---|---|---|
| CAS Number | 2580098-00-4 | Molecular Weight | 187.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl (3R)-3-amino-2,2,4-trimethylpentanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H21NO2 |
|---|---|
| Molecular Weight | 187.28 |
| InChIKey | RPUFOFMKKWIZPM-MRVPVSSYSA-N |
| SMILES | CCOC(=O)C(C)(C)C(N)C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate? |
| A: InChIKey of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate is RPUFOFMKKWIZPM-MRVPVSSYSA-N. |
| Q: What is the molecular weight of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate? |
| A: Molecular weight of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate is 187.28. |
| Q: What is the CAS number of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate? |
| A: CAS number of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate is 2580098-00-4. |
| Q: What is the molecular formula of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate? |
| A: Molecular formula of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate is C10H21NO2. |
| Q: What is the Chinese name of 2580098-00-4? |
| A: Chinese name of 2580098-00-4 is 2580098-00-4. |
| Q: What is the SMILES notation of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate? |
| A: SMILES notation of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate is CCOC(=O)C(C)(C)C(N)C(C)C. |
| Q: What is the English name of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate? |
| A: The English name of ethyl (3R)-3-amino-2,2,4-trimethylpentanoate is ethyl (3R)-3-amino-2,2,4-trimethylpentanoate. |