ethenyl acetate,methyl 2-methylprop-2-enoate,prop-2-enoic acid structure
|
Common Name | ethenyl acetate,methyl 2-methylprop-2-enoate,prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 25767-83-3 | Molecular Weight | 258.26800 | |
| Density | N/A | Boiling Point | 100.3ºC at 760mmHg | |
| Molecular Formula | C12H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 10ºC | |
| Name | ethenyl acetate,methyl 2-methylprop-2-enoate,prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 100.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.26800 |
| Flash Point | 10ºC |
| Exact Mass | 258.11000 |
| PSA | 89.90000 |
| LogP | 1.68550 |
| InChIKey | GPWRPTRDYUQHHL-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)O.C=COC(C)=O |
| Vinyl acetate,methyl methacrylate,acrylic acid polymer |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with ethenyl acetate and 2-propenoic acid |