1,1,1-trimethylol ethane trimethacrylate structure
|
Common Name | 1,1,1-trimethylol ethane trimethacrylate | ||
|---|---|---|---|---|
| CAS Number | 24690-33-3 | Molecular Weight | 324.36900 | |
| Density | 1.065g/cm3 | Boiling Point | 408.3ºC at 760mmHg | |
| Molecular Formula | C17H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176ºC | |
| Name | 1,1,1-trimethylol ethane trimethacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 408.3ºC at 760mmHg |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.36900 |
| Flash Point | 176ºC |
| Exact Mass | 324.15700 |
| PSA | 78.90000 |
| LogP | 2.35060 |
| Vapour Pressure | 7.08E-07mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | SWHLOXLFJPTYTL-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(C)(COC(=O)C(=C)C)COC(=O)C(=C)C |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-methyl-2-[[(2-methyl-1-oxoallyl)oxy]methyl]-1,3-propanediyl bismethacrylate |
| 2-Propenoic acid,2-methyl-,2-methyl-2-(((2-methyl-1-oxo-2-propenyl)oxy)methyl)-1,3-propanediyl ester |
| 2-Propenoic acid,2-methyl-,1,1'-(2-methyl-2-(((2-methyl-1-oxo-2-propen-1-yl)oxy)methyl)-1,3-propanediyl) ester |
| Trimethylolethane trimethacrylate |
| 2-methyl-2-propenoicaci2-methyl-2-[[(2-methyl-1-oxo-2-propenyl)oxy]methyl |
| Einecs 246-414-7 |
| Bismethacrylic acid 2-(methacryloyloxymethyl)-2-methylpropane-1,3-diyl ester |
| Dimethacrylic acid 2-[(methacryloyloxy)methyl]-2-methyl-1,3-propanediyl ester |
| Bismethacrylic acid 2-[(methacryloyloxy)methyl]-2-methyl-1,3-propanediyl ester |