methyl 3-(4-phenylphenyl)butanoate structure
|
Common Name | methyl 3-(4-phenylphenyl)butanoate | ||
|---|---|---|---|---|
| CAS Number | 24254-67-9 | Molecular Weight | 254.32400 | |
| Density | 1.054g/cm3 | Boiling Point | 363.5ºC at 760 mmHg | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.1ºC | |
| Name | methyl 3-(4-phenylphenyl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.054g/cm3 |
|---|---|
| Boiling Point | 363.5ºC at 760 mmHg |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.32400 |
| Flash Point | 138.1ºC |
| Exact Mass | 254.13100 |
| PSA | 26.30000 |
| LogP | 4.02020 |
| Vapour Pressure | 1.8E-05mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | CRQARNDWPSBDKT-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C)c1ccc(-c2ccccc2)cc1 |
|
~96%
methyl 3-(4-phe... CAS#:24254-67-9 |
| Literature: Neidlein; Hofmann Arzneimittel-Forschung, 1983 , vol. 33, # 5 p. 691 - 693 |
|
~%
methyl 3-(4-phe... CAS#:24254-67-9 |
| Literature: Neidlein; Hofmann Arzneimittel-Forschung, 1983 , vol. 33, # 5 p. 691 - 693 |
|
~%
methyl 3-(4-phe... CAS#:24254-67-9 |
| Literature: Howe,I. et al. Journal of the Chemical Society [Section] B: Physical Organic, 1969 , p. 439 - 445 |
| 4-Biphenylpropionicacid,b-methyl-,methyl ester (8CI) |
| 3-(4-Biphenylyl)butanoic acid methyl ester |
| [1,1'-Biphenyl]-4-propanoicacid,b-methyl-,methyl ester |
| Methyl 3-(1,1'-biphenyl-4-yl)butanoate |