Metachromins X
Modify Date: 2025-09-22 21:43:03
Metachromins X structure
|
Common Name | Metachromins X | ||
|---|---|---|---|---|
| CAS Number | 2408641-10-9 | Molecular Weight | 358.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Metachromins XMetachromins X is a sesquiterpene quinone that arrests the cell cycle progression of HeLa/Fucci2 cells at S/G2/M phase[1]. |
| Name | Metachromins X |
|---|
| Description | Metachromins X is a sesquiterpene quinone that arrests the cell cycle progression of HeLa/Fucci2 cells at S/G2/M phase[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H30O4 |
|---|---|
| Molecular Weight | 358.47 |
| InChIKey | LWZZFLJQHHLKJG-RIYZIHGNSA-N |
| SMILES | COC1=CC(=O)C(O)=C(CC=C(C)CCC2=C(C)CCCC2(C)C)C1=O |