N-(benzylideneamino)-3,5-dichloro-4-methoxybenzamide
Modify Date: 2024-04-09 11:35:27
N-(benzylideneamino)-3,5-dichloro-4-methoxybenzamide structure
|
Common Name | N-(benzylideneamino)-3,5-dichloro-4-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 23959-41-3 | Molecular Weight | 323.17400 | |
| Density | 1.3g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(benzylideneamino)-3,5-dichloro-4-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.17400 |
| Exact Mass | 322.02800 |
| PSA | 54.18000 |
| LogP | 4.34070 |
| Index of Refraction | 1.592 |
| InChIKey | WEMIEQUOVOJOSO-GIJQJNRQSA-N |
| SMILES | COc1c(Cl)cc(C(=O)NN=Cc2ccccc2)cc1Cl |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Benzoicacid,3,5-dichloro-4-methoxy-,(phenylmethylene)hydrazide (9CI) |
| N-(BENZYLIDENEAMINO)-3,5-DICHLORO-4-METHOXY-BENZAMIDE |
| p-Anisic acid,3,5-dichloro-,benzylidenehydrazide (8CI) |
| Benzoic acid,3,5-dichloro-4-methoxy-,2-(phenylmethylene)hydrazide |