(4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone
Modify Date: 2025-11-08 06:56:57
![(4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone Structure](https://www.chemsrc.com/extcaspic/117/2380098-74-6.png)
(4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone structure
|
Common Name | (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone | ||
|---|---|---|---|---|
| CAS Number | 2380098-74-6 | Molecular Weight | 270.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16F2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16F2N4O |
|---|---|
| Molecular Weight | 270.28 |
| InChIKey | XDLDVEZKESXFKJ-UHFFFAOYSA-N |
| SMILES | O=C(C1CCC(F)(F)CC1)N1CC(n2nccn2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone? |
| A: CAS number of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone is 2380098-74-6. |
| Q: What is the Chinese name of 2380098-74-6? |
| A: Chinese name of 2380098-74-6 is 2380098-74-6. |
| Q: What is the English name of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone? |
| A: The English name of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone is (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone. |
| Q: What is the InChIKey of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone? |
| A: InChIKey of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone is XDLDVEZKESXFKJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone? |
| A: SMILES notation of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone is O=C(C1CCC(F)(F)CC1)N1CC(n2nccn2)C1. |
| Q: What is the molecular weight of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone? |
| A: Molecular weight of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone is 270.28. |
| Q: What is the molecular formula of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone? |
| A: Molecular formula of (4,4-Difluorocyclohexyl)-[3-(triazol-2-yl)azetidin-1-yl]methanone is C12H16F2N4O. |