5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide structure
|
Common Name | 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2380098-01-9 | Molecular Weight | 389.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21BrN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21BrN2O3S |
|---|---|
| Molecular Weight | 389.3 |
| InChIKey | HHSFGGTUSFFMLC-UHFFFAOYSA-N |
| SMILES | O=C(NCC1(N2CCOCC2)CCSCC1)c1ccc(Br)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide? |
| A: InChIKey of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide is HHSFGGTUSFFMLC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide? |
| A: Molecular formula of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide is C15H21BrN2O3S. |
| Q: What is the Chinese name of 2380098-01-9? |
| A: Chinese name of 2380098-01-9 is 2380098-01-9. |
| Q: What is the SMILES notation of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide? |
| A: SMILES notation of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide is O=C(NCC1(N2CCOCC2)CCSCC1)c1ccc(Br)o1. |
| Q: What is the molecular weight of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide? |
| A: Molecular weight of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide is 389.3. |
| Q: What is the English name of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide? |
| A: The English name of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide is 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide. |
| Q: What is the CAS number of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide? |
| A: CAS number of 5-bromo-N-{[4-(morpholin-4-yl)thian-4-yl]methyl}furan-2-carboxamide is 2380098-01-9. |