N-[[4-butyl-6,8-bis(diethylaminooxy)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]-N-ethylethanamine structure
|
Common Name | N-[[4-butyl-6,8-bis(diethylaminooxy)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]-N-ethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 23416-06-0 | Molecular Weight | 557.97700 | |
| Density | 0.956g/cm3 | Boiling Point | 298.5ºC at 760mmHg | |
| Molecular Formula | C20H51N3O7Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.7ºC | |
| Name | N-[[4-butyl-6,8-bis(diethylaminooxy)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]-N-ethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.956g/cm3 |
|---|---|
| Boiling Point | 298.5ºC at 760mmHg |
| Molecular Formula | C20H51N3O7Si4 |
| Molecular Weight | 557.97700 |
| Flash Point | 111.7ºC |
| Exact Mass | 557.28000 |
| PSA | 74.33000 |
| LogP | 4.46480 |
| Vapour Pressure | 0.00127mmHg at 25°C |
| Index of Refraction | 1.427 |
| InChIKey | MQVJMBRYTYHBNW-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCCC(=O)O[Si](C)(C)C)(OCC)OCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-Triethoxysilyl-buttersaeure-trimethylsilylester |
| EINECS 245-233-0 |