1-butoxypropan-2-yl 2-(2,4,5-trichlorophenoxy)propanoate structure
|
Common Name | 1-butoxypropan-2-yl 2-(2,4,5-trichlorophenoxy)propanoate | ||
|---|---|---|---|---|
| CAS Number | 2317-24-0 | Molecular Weight | 383.69500 | |
| Density | 1.243g/cm3 | Boiling Point | 449.5ºC at 760mmHg | |
| Molecular Formula | C16H21Cl3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.7ºC | |
| Name | 1-butoxypropan-2-yl 2-(2,4,5-trichlorophenoxy)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 449.5ºC at 760mmHg |
| Molecular Formula | C16H21Cl3O4 |
| Molecular Weight | 383.69500 |
| Flash Point | 156.7ºC |
| Exact Mass | 382.05100 |
| PSA | 44.76000 |
| LogP | 5.16250 |
| Vapour Pressure | 2.84E-08mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | FMFKNGWZEQOWNK-UHFFFAOYSA-N |
| SMILES | CCCCOCC(C)OC(=O)C(C)Oc1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
|
~%
1-butoxypropan-... CAS#:2317-24-0 |
| Literature: Dow Chem. Co. Patent: US2749360 , 1952 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Kuron |
| Silvex,propylene glycolbutyl ether ester |