5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-one
Modify Date: 2025-09-13 17:36:07
![5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-one Structure](https://image.chemsrc.com/caspic/209/225793-33-9.png)
5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-one structure
|
Common Name | 5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 225793-33-9 | Molecular Weight | 226.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H22O2Si |
|---|---|
| Molecular Weight | 226.38700 |
| Exact Mass | 226.13900 |
| PSA | 26.30000 |
| LogP | 3.29590 |
| InChIKey | LGSMHNRGYIVLGA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC=CC(=O)C1 |
|
~88%
5-[tert-butyl(d... CAS#:225793-33-9 |
| Literature: Bolze, Patrick; Dickmeiss, Gustav; Jorgensen, Karl Anker Organic Letters, 2008 , vol. 10, # 17 p. 3753 - 3756 |
|
~%
5-[tert-butyl(d... CAS#:225793-33-9 |
| Literature: Hareau, Georges P.-J.; Koiwa, Masakazu; Hikichi, Shinichi; Sato, Fumie Journal of the American Chemical Society, 1999 , vol. 121, # 15 p. 3640 - 3650 |
|
~%
5-[tert-butyl(d... CAS#:225793-33-9 |
| Literature: Hareau, Georges P.-J.; Koiwa, Masakazu; Hikichi, Shinichi; Sato, Fumie Journal of the American Chemical Society, 1999 , vol. 121, # 15 p. 3640 - 3650 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (5R)-tert-butyldimethylsilyloxy-2-cyclohexenone |
| (5R)-5-(tert-butyldimethylsiloxy)cyclohex-2-enone |
| (R)-5-(tert-butyldimethylsiloxy)-2-cyclohexenone |
| 5-(tert-butyldimethylsilyloxy)cyclohex-2-enone |
| (5R)-5-[[(1,1-Dimethylethyl)dimethylsily]oxy]-2-cyclohexen-1-one |
| 5-[tert-butyl(dimethyl)silyl]oxy-1-cyclohex-2-enone |