3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid
Modify Date: 2025-09-01 19:15:21
3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid structure
|
Common Name | 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2229280-58-2 | Molecular Weight | 228.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14F2O2 |
|---|---|
| Molecular Weight | 228.23 |
| InChIKey | JJWTVZTYDYTZBH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(CC(=O)O)C(F)F)c(C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid? |
| A: CAS number of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid is 2229280-58-2. |
| Q: What is the InChIKey of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid? |
| A: InChIKey of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid is JJWTVZTYDYTZBH-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid? |
| A: The English name of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid is 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid. |
| Q: What is the molecular weight of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid? |
| A: Molecular weight of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid is 228.23. |
| Q: What is the molecular formula of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid? |
| A: Molecular formula of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid is C12H14F2O2. |
| Q: What is the Chinese name of 2229280-58-2? |
| A: Chinese name of 2229280-58-2 is 2229280-58-2. |
| Q: What is the SMILES notation of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid? |
| A: SMILES notation of 3-(2,4-Dimethylphenyl)-4,4-difluorobutanoic acid is Cc1ccc(C(CC(=O)O)C(F)F)c(C)c1. |