2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine
Modify Date: 2025-09-01 17:24:13
![2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine Structure](https://www.chemsrc.com/extcaspic/019/2228362-50-1.png)
2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine structure
|
Common Name | 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine | ||
|---|---|---|---|---|
| CAS Number | 2228362-50-1 | Molecular Weight | 177.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19N |
|---|---|
| Molecular Weight | 177.29 |
| InChIKey | WAZBRKMTSFLZMD-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CC=C(C3CCN3)C1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine? |
| A: InChIKey of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine is WAZBRKMTSFLZMD-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine? |
| A: CAS number of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine is 2228362-50-1. |
| Q: What is the molecular weight of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine? |
| A: Molecular weight of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine is 177.29. |
| Q: What is the SMILES notation of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine? |
| A: SMILES notation of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine is CC1(C)C2CC=C(C3CCN3)C1C2. |
| Q: What is the English name of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine? |
| A: The English name of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine is 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine. |
| Q: What is the molecular formula of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine? |
| A: Molecular formula of 2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}azetidine is C12H19N. |
| Q: What is the Chinese name of 2228362-50-1? |
| A: Chinese name of 2228362-50-1 is 2228362-50-1. |