tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate
Modify Date: 2026-07-31 21:36:59
![tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate Structure](https://www.chemsrc.com/extcaspic/357/2227685-86-9.png)
tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate structure
|
Common Name | tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2227685-86-9 | Molecular Weight | 297.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23NO5 |
|---|---|
| Molecular Weight | 297.35 |
| InChIKey | PVANNCBGBGADPF-SECBINFHSA-N |
| SMILES | COc1cc(NC(=O)OC(C)(C)C)c(C(C)O)cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate? |
| A: CAS number of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate is 2227685-86-9. |
| Q: What is the molecular weight of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate? |
| A: Molecular weight of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate is 297.35. |
| Q: What is the Chinese name of 2227685-86-9? |
| A: Chinese name of 2227685-86-9 is 2227685-86-9. |
| Q: What is the English name of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate? |
| A: The English name of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate is tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate. |
| Q: What is the SMILES notation of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate? |
| A: SMILES notation of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate is COc1cc(NC(=O)OC(C)(C)C)c(C(C)O)cc1OC. |
| Q: What is the molecular formula of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate? |
| A: Molecular formula of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate is C15H23NO5. |
| Q: What is the InChIKey of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate? |
| A: InChIKey of tert-butyl N-{2-[(1R)-1-hydroxyethyl]-4,5-dimethoxyphenyl}carbamate is PVANNCBGBGADPF-SECBINFHSA-N. |