2-aminoethanol,2-(3-chloro-4-prop-2-enoxyphenyl)acetic acid structure
|
Common Name | 2-aminoethanol,2-(3-chloro-4-prop-2-enoxyphenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 22131-80-2 | Molecular Weight | 287.73900 | |
| Density | 1.252g/cm3 | Boiling Point | 368.3ºC at 760mmHg | |
| Molecular Formula | C13H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.6ºC | |
| Name | 2-aminoethanol,2-(3-chloro-4-prop-2-enoxyphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 368.3ºC at 760mmHg |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.73900 |
| Flash Point | 176.6ºC |
| Exact Mass | 287.09200 |
| PSA | 92.78000 |
| LogP | 2.16960 |
| InChIKey | UDHFAAXTCWFTKP-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccc(CC(=O)O)cc1Cl.NCCO |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetic acid,4-allyloxy-3-chlorophenyl-,compd. with 2-aminoethanol |
| Mervan ethanolamine salt |
| Alclofenac monoethanolamine complex |
| C11H11ClO3.C2H7NO |