Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride
Modify Date: 2025-09-05 10:37:11
![Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride Structure](https://www.chemsrc.com/extcaspic/334/2208273-33-8.png)
Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride structure
|
Common Name | Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2208273-33-8 | Molecular Weight | 301.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18Cl2N2O4 |
|---|---|
| Molecular Weight | 301.16 |
| InChIKey | RTYRNNSPUSWYLN-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CNCC1(C(=O)OC)CNC2.Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride? |
| A: SMILES notation of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride is COC(=O)C12CNCC1(C(=O)OC)CNC2.Cl.Cl. |
| Q: What is the Chinese name of 2208273-33-8? |
| A: Chinese name of 2208273-33-8 is 2208273-33-8. |
| Q: What is the molecular weight of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride? |
| A: Molecular weight of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride is 301.16. |
| Q: What is the English name of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride? |
| A: The English name of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride is Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride. |
| Q: What is the InChIKey of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride? |
| A: InChIKey of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride is RTYRNNSPUSWYLN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride? |
| A: Molecular formula of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride is C10H18Cl2N2O4. |
| Q: What is the CAS number of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride? |
| A: CAS number of Dimethyl tetrahydropyrrolo[3,4-c]pyrrole-3a,6a(1H,4H)-dicarboxylate dihydrochloride is 2208273-33-8. |