[diisocyanato(methyl)silyl]oxy-diisocyanato-methylsilane structure
|
Common Name | [diisocyanato(methyl)silyl]oxy-diisocyanato-methylsilane | ||
|---|---|---|---|---|
| CAS Number | 220289-00-9 | Molecular Weight | 270.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6N4O5Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [diisocyanato(methyl)silyl]oxy-diisocyanato-methylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H6N4O5Si2 |
|---|---|
| Molecular Weight | 270.30700 |
| Exact Mass | 269.98800 |
| PSA | 126.95000 |
| InChIKey | OZTHBAQGMOUPIX-UHFFFAOYSA-N |
| SMILES | C[Si](N=C=O)(N=C=O)O[Si](C)(N=C=O)N=C=O |
|
~83%
[diisocyanato(m... CAS#:220289-00-9 |
| Literature: Gunji, Takahiro; Watanabe, Miho; Abe, Koji; Abe, Yoshimoto Bulletin of the Chemical Society of Japan, 2003 , vol. 76, # 2 p. 341 - 346 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Disiloxane,1,1,3,3-tetraisocyanato-1,3-dimethyl |
| 1,1,3,3-tetraisocyanato-1,3-dimethyldisiloxane |