[3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride
Modify Date: 2026-07-14 08:40:39
![[3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride Structure](https://www.chemsrc.com/extcaspic/335/2171858-28-7.png)
[3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride structure
|
Common Name | [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2171858-28-7 | Molecular Weight | 310.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5F7O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5F7O2S |
|---|---|
| Molecular Weight | 310.19 |
| InChIKey | OZZTZPHKMSPGKF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride? |
| A: Molecular weight of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride is 310.19. |
| Q: What is the CAS number of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride? |
| A: CAS number of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride is 2171858-28-7. |
| Q: What is the molecular formula of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride? |
| A: Molecular formula of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride is C9H5F7O2S. |
| Q: What is the SMILES notation of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride? |
| A: SMILES notation of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride is O=S(=O)(F)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1. |
| Q: What is the English name of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride? |
| A: The English name of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride is [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride. |
| Q: What is the Chinese name of 2171858-28-7? |
| A: Chinese name of 2171858-28-7 is 2171858-28-7. |
| Q: What is the InChIKey of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride? |
| A: InChIKey of [3,5-Bis(trifluoromethyl)phenyl]methanesulfonyl fluoride is OZZTZPHKMSPGKF-UHFFFAOYSA-N. |