ethyl naphthalen-1-ylcarbamothioylsulfanylformate structure
|
Common Name | ethyl naphthalen-1-ylcarbamothioylsulfanylformate | ||
|---|---|---|---|---|
| CAS Number | 20979-23-1 | Molecular Weight | 291.38900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl naphthalen-1-ylcarbamothioylsulfanylformate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO2S2 |
|---|---|
| Molecular Weight | 291.38900 |
| Exact Mass | 291.03900 |
| PSA | 102.76000 |
| LogP | 4.64680 |
| Vapour Pressure | 9.32E-08mmHg at 25°C |
| InChIKey | OJRMDJRCTJAGCW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)SC(=S)Nc1cccc2ccccc12 |
| Thiocarbonic acid anhydrosulfide with dithio-1-naphthalenecarbamic acid ethyl ester |
| Carbonic acid,thio-,anhydrosulfide with dithio-1-naphthalenecarbamic acid,ethyl ester |