5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide
Modify Date: 2025-08-26 19:00:47
![5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide Structure](https://www.chemsrc.com/extcaspic/108/2088367-69-3.png)
5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide structure
|
Common Name | 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2088367-69-3 | Molecular Weight | 261.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12ClNO2 |
|---|---|
| Molecular Weight | 261.70 |
| InChIKey | RVMYKHIGIDBNHQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(-c2cccc(C(N)=O)c2)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: SMILES notation of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide is Cc1cc(O)c(-c2cccc(C(N)=O)c2)cc1Cl. |
| Q: What is the molecular formula of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: Molecular formula of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide is C14H12ClNO2. |
| Q: What is the English name of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: The English name of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide is 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide. |
| Q: What is the Chinese name of 2088367-69-3? |
| A: Chinese name of 2088367-69-3 is 2088367-69-3. |
| Q: What is the CAS number of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: CAS number of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide is 2088367-69-3. |
| Q: What is the molecular weight of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: Molecular weight of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide is 261.70. |
| Q: What is the InChIKey of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: InChIKey of 5'-Chloro-2'-hydroxy-4'-methyl[1,1'-biphenyl]-3-carboxamide is RVMYKHIGIDBNHQ-UHFFFAOYSA-N. |