1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol
Modify Date: 2025-10-08 19:01:20
1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol structure
|
Common Name | 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol | ||
|---|---|---|---|---|
| CAS Number | 197239-55-7 | Molecular Weight | 204.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O2 |
|---|---|
| Molecular Weight | 204.26 |
| InChIKey | ZJOJHEGWCOVTDP-UHFFFAOYSA-N |
| SMILES | COc1cccc(C#CC(O)C(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 197239-55-7? |
| A: Chinese name of 197239-55-7 is 197239-55-7. |
| Q: What is the molecular formula of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol? |
| A: Molecular formula of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol is C13H16O2. |
| Q: What is the InChIKey of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol? |
| A: InChIKey of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol is ZJOJHEGWCOVTDP-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol? |
| A: CAS number of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol is 197239-55-7. |
| Q: What is the English name of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol? |
| A: The English name of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol is 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol. |
| Q: What is the molecular weight of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol? |
| A: Molecular weight of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol is 204.26. |
| Q: What is the SMILES notation of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol? |
| A: SMILES notation of 1-(3-Methoxyphenyl)-4-methyl-1-pentyn-3-ol is COc1cccc(C#CC(O)C(C)C)c1. |