N-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]acetamide
Modify Date: 2025-10-26 14:44:14
![N-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]acetamide Structure](https://image.chemsrc.com/caspic/064/195625-00-4.png)
N-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]acetamide structure
|
Common Name | N-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 195625-00-4 | Molecular Weight | 255.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17NO2 |
|---|---|
| Molecular Weight | 255.31200 |
| Exact Mass | 255.12600 |
| PSA | 52.82000 |
| LogP | 3.43770 |
| InChIKey | QPBLBBVSBIWJJZ-HOTGVXAUSA-N |
| SMILES | CC(=O)NC(c1ccccc1)C(O)c1ccccc1 |
|
~%
N-[(1S,2S)-2-hy... CAS#:195625-00-4 |
| Literature: Read; Campbell; Barker Journal of the Chemical Society, 1929 , p. 2314 |
|
~%
N-[(1S,2S)-2-hy... CAS#:195625-00-4 |
| Literature: Read; Campbell; Barker Journal of the Chemical Society, 1929 , p. 2314 |
| threo-2-Acetamino-1.2-diphenyl-aethan-1-ol |
| N-Acetyl-(-)-isodiphenyloxaethylamin |
| Acetamide,N-[(1S,2S)-2-hydroxy-1,2-diphenylethyl] |