[2-(benzenesulfonyl)-2-hex-1-ynylcyclopropyl]sulfonylbenzene structure
|
Common Name | [2-(benzenesulfonyl)-2-hex-1-ynylcyclopropyl]sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 189348-98-9 | Molecular Weight | 402.52700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(benzenesulfonyl)-2-hex-1-ynylcyclopropyl]sulfonylbenzene |
|---|
| Molecular Formula | C21H22O4S2 |
|---|---|
| Molecular Weight | 402.52700 |
| Exact Mass | 402.09600 |
| PSA | 85.04000 |
| LogP | 5.80050 |
| InChIKey | ZIEZOOVUMOOXAB-UHFFFAOYSA-N |
| SMILES | CCCCC#CC1(S(=O)(=O)c2ccccc2)CC1S(=O)(=O)c1ccccc1 |
|
~55%
[2-(benzenesulf... CAS#:189348-98-9 |
| Literature: Yoshimatsu, Mitsuhiro; Kawahigashi, Masataka; Honda, Eiji; Kataoka, Tadashi Journal of the Chemical Society - Perkin Transactions 1, 1997 , # 5 p. 695 - 700 |