6-(phenoxymethyl)-2-sulfanylidene-1H-pyrimidin-4-one structure
|
Common Name | 6-(phenoxymethyl)-2-sulfanylidene-1H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 189057-67-8 | Molecular Weight | 234.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(phenoxymethyl)-2-sulfanylidene-1H-pyrimidin-4-one |
|---|
| Molecular Formula | C11H10N2O2S |
|---|---|
| Molecular Weight | 234.27400 |
| Exact Mass | 234.04600 |
| PSA | 94.04000 |
| LogP | 2.04990 |
| InChIKey | GZLSTPJCIVNYST-UHFFFAOYSA-N |
| SMILES | O=c1cc(COc2ccccc2)[nH]c(=S)[nH]1 |
|
~63%
6-(phenoxymethy... CAS#:189057-67-8 |
| Literature: Mai, Antonello; Artico, Marino; Sbardella, Gianluca; Quartarone, Silvana; Massa, Silvio; Loi, Anna G.; De Montis, Antonella; Scintu, Franca; Putzolu, Monica; La Colla, Paolo Journal of Medicinal Chemistry, 1997 , vol. 40, # 10 p. 1447 - 1454 |
|
~%
6-(phenoxymethy... CAS#:189057-67-8 |
| Literature: Mai, Antonello; Artico, Marino; Sbardella, Gianluca; Quartarone, Silvana; Massa, Silvio; Loi, Anna G.; De Montis, Antonella; Scintu, Franca; Putzolu, Monica; La Colla, Paolo Journal of Medicinal Chemistry, 1997 , vol. 40, # 10 p. 1447 - 1454 |