4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate
Modify Date: 2025-09-05 23:33:44
4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate structure
|
Common Name | 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 1821028-59-4 | Molecular Weight | 358.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H18N2O6 |
|---|---|
| Molecular Weight | 358.3 |
| InChIKey | WOGIGTQMLVWZGU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate? |
| A: CAS number of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate is 1821028-59-4. |
| Q: What is the molecular formula of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate? |
| A: Molecular formula of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate is C18H18N2O6. |
| Q: What is the molecular weight of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate? |
| A: Molecular weight of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate is 358.3. |
| Q: What is the English name of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate? |
| A: The English name of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate is 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate. |
| Q: What is the SMILES notation of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate? |
| A: SMILES notation of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate is CC(C)(C)OC(=O)c1ccc(NC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1. |
| Q: What is the Chinese name of 1821028-59-4? |
| A: Chinese name of 1821028-59-4 is 1821028-59-4. |
| Q: What is the InChIKey of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate? |
| A: InChIKey of 4-Nitrophenyl 4-(tert-butoxycarbonyl)phenylcarbamate is WOGIGTQMLVWZGU-UHFFFAOYSA-N. |